CAS 7362-93-8
:L-Aspartic acid-4-benzyl ester
Description:
L-Aspartic acid-4-benzyl ester, with the CAS number 7362-93-8, is an organic compound derived from L-aspartic acid, an amino acid that plays a crucial role in protein synthesis and metabolism. This compound features a benzyl ester functional group, which enhances its lipophilicity compared to its parent amino acid. It typically appears as a white to off-white crystalline solid and is soluble in organic solvents, while being less soluble in water due to the presence of the hydrophobic benzyl group. The esterification of L-aspartic acid can influence its reactivity and biological activity, making it of interest in various fields, including pharmaceuticals and biochemistry. L-Aspartic acid-4-benzyl ester may be utilized in peptide synthesis and as a building block in the development of bioactive compounds. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and methods used in its synthesis and purification. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C11H13NO4
InChI:InChI=1/C11H13NO4/c12-9(6-10(13)14)11(15)16-7-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)/t9-/m0/s1
SMILES:c1ccc(cc1)COC(=O)[C@H](CC(=O)O)N
Synonyms:- H-Asp(OBzl)-OH
- (2S)-2-amino-3-benzyloxy-3-oxo-propanoic acid
- (2S)-2-amino-4-(benzyloxy)-4-oxobutanoic acid (non-preferred name)
- 3-Amino-4-(Benzyloxy)-4-Oxobutanoic Acid (Non-Preferred Name)
- 2-Amino-4-(Benzyloxy)-4-Oxobutanoic Acid (Non-Preferred Name)
- (3S)-3-ammonio-4-(benzyloxy)-4-oxobutanoate
- L-Aspartic acid benzyl ester
- L-Aspartic acid b-benzyl ester
- H-Asp-OBzl
- L-Aspartic acid 4-benzyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Benzyl L-Aspartate
CAS:Formula:C11H13NO4Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:223.23H-Asp-Obzl
CAS:M03014 - H-Asp-Obzl
Formula:C11H13NO4Purity:98%Color and Shape:SolidMolecular weight:223.228




