CAS 73622-68-1

N-(5-methylhexan-2-yl)-3-oxobutanamide

Description:

N-(5-methylhexan-2-yl)-3-oxobutanamide, with the CAS number 73622-68-1, is an organic compound characterized by its amide functional group and a ketone moiety. This substance features a branched alkyl chain, specifically a 5-methylhexan-2-yl group, which contributes to its hydrophobic characteristics. The presence of the 3-oxobutanamide structure indicates that it has both carbonyl and amine functionalities, making it a potential candidate for various chemical reactions, including condensation and acylation. The compound's molecular structure suggests it may exhibit moderate polarity due to the amide group, which can engage in hydrogen bonding. This property can influence its solubility in polar solvents. Additionally, the branched nature of the alkyl chain may affect its physical properties, such as boiling and melting points, as well as its reactivity. Overall, N-(5-methylhexan-2-yl)-3-oxobutanamide is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals, although specific applications would depend on further research and development.

Formula: C₁₁H₂₁NO₂

InChI: InChI=1/C11H21NO2/c1-8(2)5-6-9(3)12-11(14)7-10(4)13/h8-9H,5-7H2,1-4H3,(H,12,14)

SMILES: CC(C)CCC(C)N=C(CC(=O)C)O

Synonyms:

• butanamide, N-(1,4-dimethylpentyl)-3-oxo-