CymitQuimica logo

CAS 73622-78-3

:

dibenzyl (4-methylbenzene-1,3-diyl)biscarbamate

Description:
Dibenzyl (4-methylbenzene-1,3-diyl)biscarbamate, identified by its CAS number 73622-78-3, is an organic compound characterized by its structure, which features two benzyl groups and a biscarbamate functional group. This compound typically exhibits properties associated with carbamates, such as moderate solubility in organic solvents and potential reactivity with nucleophiles. Its molecular structure suggests it may have applications in various fields, including pharmaceuticals and materials science, due to its potential as a building block for more complex molecules. The presence of the 4-methylbenzene moiety may influence its physical properties, such as melting point and boiling point, as well as its reactivity. Additionally, dibenzyl (4-methylbenzene-1,3-diyl)biscarbamate may exhibit specific biological activities, which could be of interest in medicinal chemistry. However, detailed studies on its toxicity, stability, and environmental impact would be necessary to fully understand its characteristics and potential applications.
Formula:C23H22N2O4
InChI:InChI=1/C23H22N2O4/c1-17-12-13-20(24-22(26)28-15-18-8-4-2-5-9-18)14-21(17)25-23(27)29-16-19-10-6-3-7-11-19/h2-14H,15-16H2,1H3,(H,24,26)(H,25,27)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.