
CAS 73624-47-2
:B-Isopinocampheyl-9-borabicyclo[3.3.1]nonane
Description:
B-Isopinocampheyl-9-borabicyclo[3.3.1]nonane, commonly referred to as B-IPC-BBN, is a boron-containing compound notable for its utility in organic synthesis, particularly in the field of organoboron chemistry. This compound features a bicyclic structure that incorporates boron, which plays a crucial role in facilitating various chemical reactions, including cross-coupling reactions and as a reagent in the formation of carbon-carbon bonds. B-IPC-BBN is characterized by its stability and selectivity, making it a valuable tool for chemists aiming to manipulate organic molecules with precision. The presence of the isopinocampheyl group enhances its reactivity and solubility in organic solvents, which is advantageous for laboratory applications. Additionally, the compound is often used in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals, due to its ability to participate in diverse chemical transformations. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C18H31B
InChI:InChI=1S/C18H31B/c1-12-16-10-13(18(16,2)3)11-17(12)19-14-6-4-7-15(19)9-5-8-14/h12-17H,4-11H2,1-3H3
InChI key:InChIKey=VCDGSBJCRYTLNU-UHFFFAOYSA-N
SMILES:CC1C(B2C3CCCC2CCC3)CC4C(C)(C)C1C4
Synonyms:- 9-Borabicyclo[3.3.1]nonane, 9-(2,6,6-trimethylbicyclo[3.1.1]hept-3-yl)-
- B-Isopinocampheyl-9-borabicyclo[3.3.1]nonane
- 9-(2,6,6-Trimethylbicyclo[3.1.1]hept-3-yl)-9-borabicyclo[3.3.1]nonane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.