
CAS 73625-11-3
:1,3,4,5-Tetrahydro-N,N-dimethylbenz[cd]indol-4-amine
Description:
1,3,4,5-Tetrahydro-N,N-dimethylbenz[cd]indol-4-amine, with CAS number 73625-11-3, is a chemical compound that belongs to the class of indole derivatives. It features a bicyclic structure that includes a fused indole ring system, which is characteristic of many biologically active compounds. The presence of the tetrahydro group indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring structure. The dimethylamino group contributes to its basicity and potential for forming salts. This compound may exhibit interesting pharmacological properties, making it a subject of research in medicinal chemistry. Its structural features suggest potential interactions with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. However, specific data on its solubility, stability, and reactivity would depend on experimental conditions and require further investigation. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H16N2
InChI:InChI=1S/C13H16N2/c1-15(2)11-6-9-4-3-5-12-13(9)10(7-11)8-14-12/h3-5,8,11,14H,6-7H2,1-2H3
InChI key:InChIKey=BQOANWOQEHVATQ-UHFFFAOYSA-N
SMILES:N(C)(C)C1CC=2C3=C(C1)C=CC=C3NC2
Synonyms:- Benz[cd]indol-4-amine, 1,3,4,5-tetrahydro-N,N-dimethyl-
- 1,3,4,5-Tetrahydro-N,N-dimethylbenz[cd]indol-4-amine
- N,N-Dimethyl-1,3,4,5-tetrahydrobenzo[cd]indol-4-amine
- RU 28306
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.