
CAS 73627-19-7
:1,2,3,4-Tetrahydro-1,2-dimethylpyrrolo[1,2-a]pyrazine
Description:
1,2,3,4-Tetrahydro-1,2-dimethylpyrrolo[1,2-a]pyrazine is a bicyclic organic compound characterized by its unique fused ring structure, which incorporates both a pyrrole and a pyrazine moiety. This compound features two methyl groups attached to the nitrogen atoms in the pyrrole ring, contributing to its overall stability and reactivity. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of nitrogen atoms in its structure imparts basic properties, making it potentially reactive in various chemical environments. This compound may exhibit interesting biological activities, which could be explored for applications in pharmaceuticals or agrochemicals. Its CAS number, 73627-19-7, allows for easy identification and retrieval of information in chemical databases. As with many nitrogen-containing heterocycles, it may participate in diverse chemical reactions, including nucleophilic substitutions and cycloadditions, making it a subject of interest in synthetic organic chemistry.
Formula:C9H14N2
InChI:InChI=1S/C9H14N2/c1-8-9-4-3-5-11(9)7-6-10(8)2/h3-5,8H,6-7H2,1-2H3
InChI key:InChIKey=VNJXRHVMRBYMPR-UHFFFAOYSA-N
SMILES:CC1C=2N(CCN1C)C=CC2
Synonyms:- Pyrrolo[1,2-a]pyrazine, 1,2,3,4-tetrahydro-1,2-dimethyl-
- 1,2,3,4-Tetrahydro-1,2-dimethylpyrrolo[1,2-a]pyrazine
- 1,2-Dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.