CymitQuimica logo

CAS 73630-93-0

:

1-bromo-N,N,2-trimethylprop-1-en-1-amine

Description:
1-Bromo-N,N,2-trimethylprop-1-en-1-amine is an organic compound characterized by the presence of a bromine atom and an amine functional group. It features a propene backbone with a double bond, which contributes to its reactivity, particularly in addition reactions. The presence of the trimethyl groups indicates that the compound has a branched structure, which can influence its steric properties and overall stability. As a bromoamine, it may exhibit both nucleophilic and electrophilic characteristics, making it useful in various synthetic applications, including organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The compound's reactivity can also be affected by the bromine substituent, which can participate in substitution reactions. Additionally, the presence of the double bond suggests potential for polymerization or other reactions that involve the formation of new bonds. Safety data should be consulted for handling and storage, as halogenated amines can pose health risks.
Formula:C6H12BrN
InChI:InChI=1/C6H12BrN/c1-5(2)6(7)8(3)4/h1-4H3
SMILES:CC(=C(Br)N(C)C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.