CAS 73635-75-3
:Benzaldehyde, 4,5-dihydroxy-2-nitro-
Description:
Benzaldehyde, 4,5-dihydroxy-2-nitro- is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with both hydroxyl (-OH) and nitro (-NO2) groups. The presence of these functional groups imparts unique chemical properties, including increased reactivity and potential for hydrogen bonding due to the hydroxyl groups. This compound typically exhibits a pale yellow to brownish color and may have a distinct odor reminiscent of almonds, which is common among benzaldehyde derivatives. It is soluble in organic solvents and may have limited solubility in water, depending on the specific conditions. The nitro group contributes to its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. Additionally, the dihydroxy substitution pattern can influence its biological activity, making it of interest in medicinal chemistry and research. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C7H5NO5
InChI:InChI=1S/C7H5NO5/c9-3-4-1-6(10)7(11)2-5(4)8(12)13/h1-3,10-11H
InChI key:SDAAKNQPCGUCNH-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1O)O)[N+](=O)[O-])C=O
Synonyms:- 3,4-Dihydroxy-6-Nitrobenzaldehyde
- 2-Nitro-4,5-Dihydroxybenzaldehyde
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4,5-Dihydroxy-2-nitrobenzaldehyde
CAS:4,5-Dihydroxy-2-nitrobenzaldehydeFormula:C7H5NO5Purity:95%Molecular weight:183.11834,5-Dihydroxy-2-nitrobenzaldehyde
CAS:Formula:C7H5NO5Purity:98%Color and Shape:SolidMolecular weight:183.11834,5-Dihydroxy-2-nitrobenzaldehyde
CAS:Controlled ProductApplications 4,5-Dihydroxy-2-nitrobenzaldehyde is used as a reagent in the synthesis of 5,6-diacetoxyindole which is a stable eumelanin precursor. 4,5-Dihydroxy-2-nitrobenzaldehyde is also used in the preparation of 6-aminoisoproterenol which is an impurity of the non-selective beta-adrenergic agonist, Isoproterenol (I874200, HCl).
References Murphy, B.P.: J. Org. Chem., 50, 5873 (1985); Avery, M.A., et al.: J. Org. Chem., 45, 2750 (1980); Kikkawa, H. et al.: Biol. Pharmac. Bull., 17, 1047 (1994); Kral, P. et al.: Psychopharmacologia, 26, 79 (1972); Giles, R.E. et al.: J. Pharmacol. Exp. Ther., 186, 472 (1973)Formula:C7H5NO5Color and Shape:NeatMolecular weight:183.124,5-Dihydroxy-2-nitrobenzaldehyde
CAS:4,5-Dihydroxy-2-nitrobenzaldehydeFormula:C7H5NO5Purity:95+%Molecular weight:183.123,4-Dihydroxy-6-nitrobenzaldehyde
CAS:3,4-Dihydroxy-6-nitrobenzaldehyde is a nitrite that can be used to produce nitric acid. It can also be used in the synthesis of caffeic acid and protocatechuic aldehyde. This molecule is also a catalyst for the conversion of 3,4-dihydroxybenzoic acid to chloride and purine derivatives. 3,4-Dihydroxy-6-nitrobenzaldehyde is nucleophilic and can react with an electron pair donor such as methyl ester or dimerization. The product of this reaction is an unsaturated compound called hyperuricemic mice.Formula:C7H5NO5Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:183.12 g/mol3,4-Dihydroxy-6-nitrobenzaldehyde
CAS:Formula:C7H5NO5Purity:95.0%Color and Shape:SolidMolecular weight:183.119





