CAS 7364-26-3
:1,2-Dihydro-5-methyl-3H-indazol-3-one
Description:
1,2-Dihydro-5-methyl-3H-indazol-3-one, with the CAS number 7364-26-3, is a heterocyclic organic compound characterized by its indazole structure, which consists of a fused five-membered ring containing nitrogen atoms. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, such as ethanol and dimethyl sulfoxide, but may have limited solubility in water. The presence of the methyl group at the 5-position contributes to its unique chemical properties, influencing its reactivity and potential applications. 1,2-Dihydro-5-methyl-3H-indazol-3-one is of interest in medicinal chemistry due to its potential biological activities, including anti-inflammatory and analgesic effects. Its structure allows for various modifications, making it a versatile scaffold for drug development. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c1-5-2-3-7-6(4-5)8(11)10-9-7/h2-4H,1H3,(H2,9,10,11)
InChI key:InChIKey=GACMQQYUAANTJH-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC=C(C)C2)NN1
Synonyms:- 5-Methyl-3-indazolinone
- 3H-Indazol-3-one, 1,2-dihydro-5-methyl-
- 1,2-Dihydro-5-methyl-3H-indazol-3-one
- 3-Indazolinone, 5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
