CAS 7364-30-9
:5,7-Dichloro-1,2-dihydro-3H-indazol-3-one
Description:
5,7-Dichloro-1,2-dihydro-3H-indazol-3-one is a chemical compound characterized by its indazole core, which features two chlorine substituents at the 5 and 7 positions. This compound is typically a solid at room temperature and exhibits a crystalline structure. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The presence of the dichloro substituents can influence its reactivity and interaction with biological targets. The compound's molecular structure includes a carbonyl group, contributing to its chemical properties and reactivity. It is important to handle this substance with care, as it may pose health risks, and appropriate safety measures should be taken during its use in laboratory settings. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions, which are crucial factors to consider in practical applications.
Formula:C7H4Cl2N2O
InChI:InChI=1S/C7H4Cl2N2O/c8-3-1-4-6(5(9)2-3)10-11-7(4)12/h1-2H,(H2,10,11,12)
InChI key:InChIKey=NOEFPHNWRCXXLC-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC(Cl)=C1)C(=O)NN2
Synonyms:- 5,7-Dichloro-1,2-dihydro-3H-indazol-3-one
- 3-Indazolinone, 5,7-dichloro-
- 3H-Indazol-3-one, 5,7-dichloro-1,2-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
