CAS 73647-04-8
:(E)-ethyl 2-(2-(4-nitrophenyl)hydrazono propanoate
Description:
(E)-ethyl 2-(2-(4-nitrophenyl)hydrazono)propanoate, with the CAS number 73647-04-8, is an organic compound characterized by its hydrazone functional group, which is formed from the reaction of a hydrazine derivative with a carbonyl compound. This compound typically exhibits a yellow to orange color due to the presence of the nitrophenyl group, which can influence its electronic properties and reactivity. It is likely to be soluble in organic solvents, such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic characteristics. The nitro group can impart significant polarity and may also affect the compound's biological activity, making it of interest in various fields, including medicinal chemistry and materials science. The compound's structure suggests potential applications in the synthesis of dyes, pharmaceuticals, or as intermediates in organic synthesis. As with many organic compounds, safety precautions should be taken when handling it, as nitro compounds can be hazardous.
Formula:C11H13N3O4
InChI:InChI=1/C11H13N3O4/c1-3-18-11(15)8(2)12-13-9-4-6-10(7-5-9)14(16)17/h4-7,13H,3H2,1-2H3/b12-8+
Synonyms:- Ethyl (2Z)-2-[(4-nitrophenyl)hydrazono]propanoate
- Propanoic acid, 2-[2-(4-nitrophenyl)hydrazinylidene]-, ethyl ester, (2Z)-
- ethyl (2E)-2-[(4-nitrophenyl)hydrazono]propanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.