CAS 73649-99-7
:[1-(hexadecanoyloxymethyl)-2-hydroxy-ethyl] (9E,12Z)-octadeca-9,12-dienoate
Description:
The chemical substance known as [1-(hexadecanoyloxymethyl)-2-hydroxy-ethyl] (9E,12Z)-octadeca-9,12-dienoate, with the CAS number 73649-99-7, is a complex ester derived from fatty acids and glycerol. It features a long-chain fatty acid moiety, specifically hexadecanoyl, which contributes to its hydrophobic characteristics, making it soluble in organic solvents but less so in water. The presence of the hydroxyethyl group indicates that it has potential for hydrogen bonding, which can enhance its solubility in polar solvents. The (9E,12Z)-octadeca-9,12-dienoate part of the molecule signifies that it contains a conjugated system of double bonds, which can impart unique reactivity and stability properties, as well as potential applications in biochemistry and materials science. This compound may exhibit surfactant properties due to its amphiphilic nature, making it useful in formulations for pharmaceuticals, cosmetics, or as an emulsifier in various industrial applications. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is used.
Formula:C37H68O5
InChI:InChI=1/C37H68O5/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-37(40)42-35(33-38)34-41-36(39)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h11,13,17-18,35,38H,3-10,12,14-16,19-34H2,1-2H3/b13-11-,18-17+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Palmitoyl-2-linoleoyl-rac-glycerol-d5
CAS:Controlled Product<p>Stability Temperature Sensitive<br>Applications 1-Palmitoyl-2-linoleoyl-rac-glycerol-d5 is labelled 1-Palmitoyl-2-linoleoyl-rac-glycerol (P159000) which is a fatty acid ester with glycerol from pea leaves and germinating soya beans.<br>References Froeling, A., et al.: Chem. Physics Lipids, 36, 29 (1984); Spyros, A., et al.: J. Agric. Food Chem., 52, 157 (2004); Larrea, V., et al.: Food Chem., 102, 494 (2007)<br></p>Formula:C37D5H63O5Color and Shape:NeatMolecular weight:597.964

