CAS 73663-95-3
:N-(4-fluorophenyl)-5H-purin-6-amine
Description:
N-(4-fluorophenyl)-5H-purin-6-amine, with the CAS number 73663-95-3, is a chemical compound that belongs to the purine class of molecules. It features a purine core structure, which is characterized by a fused double-ring system containing nitrogen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, which can influence the compound's biological activity and solubility. This compound is often studied for its potential pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the purine structure can lead to compounds with antiviral or anticancer activities. Its molecular structure suggests that it may engage in hydrogen bonding and other interactions typical of nitrogen-containing heterocycles. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it a subject of interest in drug design. As with many purine derivatives, it may also exhibit interactions with biological targets such as enzymes or receptors, contributing to its potential therapeutic applications.
Formula:C11H8FN5
InChI:InChI=1/C11H8FN5/c12-7-1-3-8(4-2-7)17-11-9-10(14-5-13-9)15-6-16-11/h1-6,9H,(H,13,14,15,16,17)
SMILES:c1cc(ccc1F)NC1=NC=NC2=NC=NC12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
