CAS 73664-32-1
:2-[(naphthalen-1-ylacetyl)amino]ethanaminium chloride
Description:
2-[(Naphthalen-1-ylacetyl)amino]ethanaminium chloride, with the CAS number 73664-32-1, is a chemical compound characterized by its structure, which includes a naphthalene moiety linked to an acetylamino group and an ethanaminium component. This compound typically exhibits properties associated with quaternary ammonium salts, such as solubility in water and the ability to act as a cationic surfactant. Its molecular structure suggests potential applications in pharmaceuticals, particularly in drug delivery systems or as an antimicrobial agent, due to the presence of the naphthalene ring, which can enhance biological activity. The chloride ion contributes to its ionic nature, influencing its solubility and interaction with biological membranes. Additionally, the compound may exhibit specific reactivity patterns typical of amines and amides, making it a candidate for further chemical modifications or derivatizations in synthetic organic chemistry. Overall, its unique structural features and properties make it a subject of interest in various fields, including medicinal chemistry and materials science.
Formula:C14H17ClN2O
InChI:InChI=1/C14H16N2O.ClH/c15-8-9-16-14(17)10-12-6-3-5-11-4-1-2-7-13(11)12;/h1-7H,8-10,15H2,(H,16,17);1H
SMILES:c1ccc2c(c1)cccc2CC(=NCCN)O.Cl
Synonyms:- 1-Naphthaleneacetamide, N- (2-aminoethyl)-, monohydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(2-Aminoethyl)-2-(naphthalen-1-yl)acetamide Hydrochloride (Naphthylacetylethylenediamine Hydrochloride)
CAS:Controlled ProductFormula:C14H16N2O·ClHColor and Shape:NeatMolecular weight:264.75
