
CAS 7367-79-5
:Behenic acid tryptamide
Description:
Behenic acid tryptamide, with the CAS number 7367-79-5, is a chemical compound that combines behenic acid, a long-chain fatty acid, with tryptamine, an indole alkaloid. This compound is characterized by its structural features, which include a long hydrophobic alkyl chain derived from behenic acid, contributing to its lipid solubility and potential bioactivity. The tryptamine moiety introduces properties associated with neurotransmitter activity, as tryptamines are known for their roles in biological systems, particularly in relation to serotonin. Behenic acid tryptamide may exhibit amphiphilic characteristics, allowing it to interact with both lipid and aqueous environments, which can influence its solubility and biological interactions. This compound is of interest in various fields, including pharmacology and biochemistry, due to its potential applications in drug formulation and as a bioactive agent. However, detailed studies on its specific biological activities and mechanisms of action are necessary to fully understand its potential uses and effects.
Formula:C32H54N2O
InChI:InChI=1S/C32H54N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-32(35)33-27-26-29-28-34-31-24-22-21-23-30(29)31/h21-24,28,34H,2-20,25-27H2,1H3,(H,33,35)
InChI key:InChIKey=HAWFHRQOMIMGFR-UHFFFAOYSA-N
SMILES:C(CNC(CCCCCCCCCCCCCCCCCCCCC)=O)C=1C=2C(NC1)=CC=CC2
Synonyms:- Docosanamide, N-[2-(1H-indol-3-yl)ethyl]-
- Docosanamide, N-(2-indol-3-ylethyl)-
- N-Behenoyltryptamine
- N-[2-(1H-Indol-3-yl)ethyl]docosanamide
- Behenic acid tryptamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Docosanoic acid tryptamide
CAS:Docosanoic acid tryptamide is a fatty acid that has been shown to be involved in the modulation of serotonin synthesis. Docosanoic acid tryptamide is synthesized from tricosanoic acid, which is a fatty acid. Docosanoic acid tryptamide can be used as an analytical reagent for the identification of fatty acids by mass spectrometry and as primers for polymerase chain reactions to identify fatty acids in DNA. The sequence of docosanoic acid tryptamide is C20:4 (Omega-6) and its molecular weight is 296 Daltons. Docosanoic acid tryptamide can also be used for the separation of pentacosanoic acids by electrophoresis.Formula:C32H54N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:482.8 g/mol

