CAS 73674-95-0
:L-methionyl-L-tyrosyl-L-lysine
Description:
L-methionyl-L-tyrosyl-L-lysine, with the CAS number 73674-95-0, is a synthetic peptide composed of three amino acids: methionine, tyrosine, and lysine. This compound is characterized by its specific sequence of amino acids, which contributes to its unique properties and potential biological activities. As a peptide, it exhibits characteristics typical of amino acid chains, such as solubility in water and the ability to form hydrogen bonds. The presence of methionine provides sulfur-containing properties, while tyrosine contributes aromatic characteristics, and lysine introduces a positively charged side chain at physiological pH. These features may influence the peptide's stability, reactivity, and interactions with biological systems. L-methionyl-L-tyrosyl-L-lysine may have applications in biochemistry and pharmaceuticals, particularly in studies related to protein synthesis, enzyme activity, or as a potential therapeutic agent. However, specific biological activities and applications would require further investigation and validation through experimental studies.
Formula:C20H32N4O5S
InChI:InChI=1/C20H32N4O5S/c1-30-11-9-15(22)18(26)24-17(12-13-5-7-14(25)8-6-13)19(27)23-16(20(28)29)4-2-3-10-21/h5-8,15-17,25H,2-4,9-12,21-22H2,1H3,(H,23,27)(H,24,26)(H,28,29)/t15-,16-,17-/m0/s1
SMILES:CSCC[C@@H](C(=N[C@@H](Cc1ccc(cc1)O)C(=N[C@@H](CCCCN)C(=O)O)O)O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methionyl-tyrosyl-lysine
CAS:<p>Methionyl-tyrosyl-lysine is a tripeptide from the spinal cord.</p>Formula:C20H32N4O5SColor and Shape:SolidMolecular weight:440.56H-Met-Tyr-Lys-OH
CAS:<p>H-Met-Tyr-Lys-OH is a synthetic amino acid that is used as a neurotransmitter. It is active in the brain, where it has been shown to be involved in the regulation of muscle contraction and dl-homocysteic acid synthesis. H-Met-Tyr-Lys-OH may also be involved in the regulation of nerve growth factor production and synaptic transmission. HMTL shows resistance to metabolism by aldolase, which may be due to its role in regulating endogenous levels of serotonin.</p>Formula:C20H32N4O5SPurity:Min. 95%Molecular weight:440.56 g/mol

