CymitQuimica logo

CAS 73675-60-2

:

(5E,9Z)-4-hydroxy-6-methyl-3-methylidene-2-oxo-2,3,3a,4,7,8,11,11a-octahydrocyclodeca[b]furan-10-carbaldehyde

Description:
The chemical substance known as (5E,9Z)-4-hydroxy-6-methyl-3-methylidene-2-oxo-2,3,3a,4,7,8,11,11a-octahydrocyclodeca[b]furan-10-carbaldehyde, with the CAS number 73675-60-2, is a complex organic compound characterized by its unique bicyclic structure. This compound features multiple functional groups, including a hydroxyl group (-OH), a carbonyl group (C=O), and an aldehyde group (-CHO), which contribute to its reactivity and potential applications in organic synthesis. The presence of the methylidene and methyl groups indicates that it has a degree of unsaturation, which can influence its chemical behavior and interactions. The stereochemistry, denoted by the (5E,9Z) configuration, suggests specific spatial arrangements of the substituents around the double bonds, which can affect the compound's biological activity and physical properties. Such compounds are often of interest in medicinal chemistry and natural product synthesis due to their structural complexity and potential for diverse biological activities.
Formula:C15H18O4
InChI:InChI=1/C15H18O4/c1-9-4-3-5-11(8-16)7-13-14(12(17)6-9)10(2)15(18)19-13/h5-6,8,12-14,17H,2-4,7H2,1H3/b9-6+,11-5-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.