CAS 73686-77-8
:4-(propylamino)benzoic acid
Description:
4-(Propylamino)benzoic acid, also known as para-propylaminobenzoic acid, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a propylamino group at the para position. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The propylamino group contributes to its basicity, allowing it to participate in various chemical reactions, including acylation and amination. 4-(Propylamino)benzoic acid may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs or as a potential intermediate in organic synthesis. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c1-2-7-11-9-5-3-8(4-6-9)10(12)13/h3-6,11H,2,7H2,1H3,(H,12,13)
SMILES:CCCNc1ccc(cc1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.