CAS 736905-51-4

(1E)-3-methoxypropanimidamide

Description:

(1E)-3-methoxypropanimidamide, with the CAS number 736905-51-4, is an organic compound characterized by its unique functional groups and structural features. It contains a methoxy group (-OCH3) attached to a propanimidamide backbone, which includes an amidine functional group characterized by the presence of a carbon-nitrogen double bond. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents due to the presence of the methoxy group, which enhances its ability to interact with other polar molecules. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its reactivity is influenced by the amidine group, which can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Overall, (1E)-3-methoxypropanimidamide is a versatile compound with potential applications in pharmaceuticals and organic synthesis.

Formula: C₄H₁₀N₂O

InChI: InChI=1/C4H10N2O/c1-7-3-2-4(5)6/h2-3H2,1H3,(H3,5,6)

SMILES: COCCC(=N)N

3-METHOXYPROPANIMIDAMIDE

CAS: 736905-51-4

Formula: C₄H₁₀N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 102.1350

Ref: IN-DA005LT9

3-Methoxypropanimidamide

CAS: 736905-51-4

Purity: 95+%

Molecular weight: 102.137001

Ref: 10-F609313