CAS 73692-50-9: 2′,4,4′,6′-Tetrahydroxychalcone
Description:2′,4,4′,6′-Tetrahydroxychalcone is a flavonoid compound characterized by its chalcone structure, which consists of two aromatic rings connected by a three-carbon α,β-unsaturated carbonyl system. This specific compound features four hydroxyl (-OH) groups located at the 2′, 4, 4′, and 6′ positions of the aromatic rings, contributing to its potential antioxidant properties. It is typically a yellow crystalline solid, soluble in organic solvents, and exhibits moderate solubility in water due to the presence of multiple hydroxyl groups. The compound is of interest in various fields, including pharmacology and food science, due to its potential health benefits, such as anti-inflammatory and antimicrobial activities. Additionally, its structural characteristics allow it to participate in various chemical reactions, making it a valuable compound for synthetic organic chemistry. As with many flavonoids, its biological activities may be influenced by its structural configuration, making it a subject of ongoing research in natural product chemistry.
Formula:C15H12O5
InChI:InChI=1S/C15H12O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-8,16-17,19-20H
InChI key:InChIKey=YQHMWTPYORBCMF-UHFFFAOYSA-N
SMILES:O=C(C=CC1=CC=C(O)C=C1)C=2C(O)=CC(O)=CC2O
- Synonyms:
- 2-Propen-1-one, 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-
- 2′,4,4′,6′-Tetrahydroxychalcone
- 3-(4-Hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-2-propen-1-one
- 4,2′,4′,6′-Tetrahydroxychalcone
- Chalcone, 2′,4,4′,6′-tetrahydroxy-
