CAS 73692-51-0

2′,4′,6′,3,4-Pentahydroxychalcone

Description:

2′,4′,6′,3,4-Pentahydroxychalcone is a flavonoid compound characterized by its multiple hydroxyl groups, which contribute to its solubility and reactivity. This compound features a chalcone backbone, consisting of two aromatic rings connected by a three-carbon α,β-unsaturated carbonyl system. The presence of five hydroxyl groups enhances its antioxidant properties, making it of interest in various biological and pharmacological studies. It exhibits potential health benefits, including anti-inflammatory and anti-cancer activities, attributed to its ability to scavenge free radicals and modulate cellular signaling pathways. Additionally, the structural configuration of 2′,4′,6′,3,4-Pentahydroxychalcone allows for various interactions with biological macromolecules, which may influence its efficacy in therapeutic applications. Its solubility in polar solvents and stability under certain conditions further define its utility in research and potential industrial applications. Overall, this compound represents a significant area of interest in natural product chemistry and medicinal research.

Formula: C₁₅H₁₂O₆

InChI: InChI=1S/C15H12O6/c16-9-6-13(20)15(14(21)7-9)11(18)4-2-8-1-3-10(17)12(19)5-8/h1-7,16-17,19-21H

InChI key: InChIKey=CRBYNQCDRNZCNX-UHFFFAOYSA-N

SMILES: C(C=CC1=CC(O)=C(O)C=C1)(=O)C2=C(O)C=C(O)C=C2O

Synonyms:

• 3,4,2′,4′,6-Pentahydroxychalcone
• 3-(3,4-Dihydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-2-propen-1-one
• 2-Propen-1-one, 3-(3,4-dihydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-
• 2',3,4,4',6'-Pentahydroxychalcone
• 2′,4′,6′,3,4-Pentahydroxychalcone

2',4',6',3,4-Pentahydroxychalcone

CAS: 73692-51-0

2',4',6',3,4-Pentahydroxychalcone is a natural flavonoid compound, which is derived from various plant sources, typically those found in certain fruits, vegetables, and herbs known for their bioactive properties. This compound is part of the broader chalcone family, known for their diverse biological activities.

Formula: C₁₅H₁₂O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 288.25 g/mol

Ref: 3D-FP65728