CAS 73692-57-6

5,6-Diamino-1,3-naphthalenedisulfonic acid

Description:

5,6-Diamino-1,3-naphthalenedisulfonic acid is an organic compound characterized by its naphthalene structure, which features two amino groups and two sulfonic acid groups. This compound is typically a dark-colored solid that is soluble in water due to the presence of the sulfonic acid groups, which enhance its hydrophilicity. The amino groups can participate in various chemical reactions, making it useful in dye chemistry and as a reagent in organic synthesis. Its sulfonic acid groups contribute to its acidic properties, allowing it to act as a strong acid in solution. This compound is often employed in the production of azo dyes and as an intermediate in the synthesis of other chemical compounds. Additionally, it may exhibit biological activity, although specific applications in pharmaceuticals or biochemistry would require further investigation. Overall, 5,6-Diamino-1,3-naphthalenedisulfonic acid is notable for its functional groups that enable diverse chemical reactivity and applications in various fields.

Formula: C₁₀H₁₀N₂O₆S₂

InChI: InChI=1S/C10H10N2O6S2/c11-8-2-1-6-7(10(8)12)3-5(19(13,14)15)4-9(6)20(16,17)18/h1-4H,11-12H2,(H,13,14,15)(H,16,17,18)

InChI key: InChIKey=KHEHRJJAWUJGDW-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C=1C2=C(C=C(S(=O)(=O)O)C1)C(N)=C(N)C=C2

Synonyms:

• 1,2-Diamino-5,7-naphthalenedisulfonic acid
• 1,3-Naphthalenedisulfonic acid, 5,6-diamino-
• 5,6-Diamino-1,3-naphthalenedisulfonic acid
• 5,6-Diaminonaphthalene-1,3-Disulfonic Acid
• 5,6-Diaminonaphthalene-1,3-disulphonic acid

1,2-Diaminonaphthalene-5,7-disulfonic acid

CAS: 73692-57-6

1,2-Diaminonaphthalene-5,7-disulfonic acid is a white solid that is soluble in water. It is prepared by the reaction of naphthalene with aqueous ammonia in the presence of an alkali. This compound undergoes hydrolysis to produce 1,2-diaminonaphthalene and hydrogen sulfide. The process can be carried out at low temperatures and produces a high yield. The effluent from this process has been found to have no adverse effects on the environment or human health.

Formula: C₁₀H₁₀N₂O₆S₂

Purity: Min. 95%

Molecular weight: 318.33 g/mol

Ref: 3D-FD37504