CAS 736949-15-8
:2-Cyano-3-[1-(2-fluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-propenoic acid
Description:
2-Cyano-3-[1-(2-fluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-propenoic acid, with CAS number 736949-15-8, is a synthetic organic compound characterized by its complex structure, which includes a cyano group, a propenoic acid moiety, and a pyrrole derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the cyano and carboxylic acid functional groups. The fluorophenyl substituent may influence its electronic properties, potentially enhancing its biological activity or reactivity in chemical reactions. The presence of the pyrrole ring contributes to its aromatic character and may affect its stability and interaction with other molecules. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest for further research and application in various chemical fields.
Formula:C16H13FN2O2
InChI:InChI=1S/C16H13FN2O2/c1-10-7-12(8-13(9-18)16(20)21)11(2)19(10)15-6-4-3-5-14(15)17/h3-8H,1-2H3,(H,20,21)
InChI key:InChIKey=GWHMXMMDGPZBAN-UHFFFAOYSA-N
SMILES:CC=1N(C(C)=CC1C=C(C(O)=O)C#N)C2=C(F)C=CC=C2
Synonyms:- 2-Propenoic acid, 2-cyano-3-[1-(2-fluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-
- 2-Cyano-3-[1-(2-fluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-propenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.