CAS 73696-28-3

1-[(4-methylphenyl)sulfonyl]pyrrolidin-3-one

Description:

1-[(4-methylphenyl)sulfonyl]pyrrolidin-3-one, identified by its CAS number 73696-28-3, is a chemical compound characterized by its pyrrolidinone core structure, which features a sulfonyl group attached to a 4-methylphenyl moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its polar nature due to the sulfonyl functional group. The presence of the pyrrolidinone ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit biological activity related to its structural features. The sulfonyl group can enhance the compound's reactivity and interaction with biological targets. Additionally, the methyl group on the phenyl ring can influence the compound's lipophilicity and overall pharmacokinetic properties. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would depend on its concentration and exposure levels.

Formula: C₁₁H₁₃NO₃S

InChI: InChI=1/C11H13NO3S/c1-9-2-4-11(5-3-9)16(14,15)12-7-6-10(13)8-12/h2-5H,6-8H2,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)N1CCC(=O)C1

Synonyms:

• 1-(4-Tolylsulfonyl)pyrrolidin-3-one
• 1-[(4-Methylphenyl)sulfonyl]-3-pyrrolidinone

1-tosylpyrrolidin-3-one

CAS: 73696-28-3

Formula: C₁₁H₁₃NO₃S

Purity: 95.0%

Molecular weight: 239.29

Ref: 10-F496517