
CAS 736987-79-4
:2-[(1E)-2-(2-Furanyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-[(1E)-2-(2-Furanyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which features a boron atom coordinated to two oxygen atoms and a carbon framework. This compound contains a furan ring, contributing to its aromatic properties and potential reactivity. The presence of the ethenyl group indicates that it has unsaturation, which can participate in various chemical reactions, such as polymerization or cross-coupling reactions. The tetramethyl substituents enhance its steric bulk, potentially influencing its reactivity and solubility in organic solvents. This compound may exhibit interesting optical properties due to the conjugation between the furan and the ethenyl moiety. Additionally, its boron content suggests potential applications in materials science, organic synthesis, and medicinal chemistry, particularly in the development of boron-containing drugs or catalysts. Overall, the combination of its structural features makes it a compound of interest in various fields of chemical research.
Formula:C12H17BO3
InChI:InChI=1S/C12H17BO3/c1-11(2)12(3,4)16-13(15-11)8-7-10-6-5-9-14-10/h5-9H,1-4H3/b8-7+
InChI key:InChIKey=BYMFJKPCMNSXKV-BQYQJAHWSA-N
SMILES:C(=C/C1=CC=CO1)\B2OC(C)(C)C(C)(C)O2
Synonyms:- 2-[(1E)-2-(2-Furanyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 2-[(1E)-2-(2-furanyl)ethenyl]-4,4,5,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.