CAS 736989-94-9

4-Bromo-N-cyclohexyl-2-fluorobenzamide

Description:

4-Bromo-N-cyclohexyl-2-fluorobenzamide is an organic compound characterized by its unique molecular structure, which includes a bromine atom and a fluorine atom attached to a benzamide framework. The presence of the cyclohexyl group contributes to its hydrophobic characteristics, while the bromine and fluorine substituents can influence its reactivity and polarity. This compound is likely to exhibit moderate solubility in organic solvents due to its non-polar cyclohexyl moiety, while the polar amide functional group may enhance its interactions with polar solvents. The bromine and fluorine atoms can also affect the compound's electronic properties, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions or coupling reactions. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can interact with biological targets. Overall, 4-Bromo-N-cyclohexyl-2-fluorobenzamide is a compound of interest for further study in both synthetic and applied chemistry contexts.

Formula: C₁₃H₁₅BrFNO

InChI: InChI=1S/C13H15BrFNO/c14-9-6-7-11(12(15)8-9)13(17)16-10-4-2-1-3-5-10/h6-8,10H,1-5H2,(H,16,17)

InChI key: InChIKey=CZZKELBHYUIJHM-UHFFFAOYSA-N

SMILES: C(NC1CCCCC1)(=O)C2=C(F)C=C(Br)C=C2

Synonyms:

• 4-Bromo-N-cyclohexyl-2-fluorobenzamide
• Benzamide, 4-bromo-N-cyclohexyl-2-fluoro-