CAS 736991-24-5

2-[2-(4-Morpholinyl)ethyl]benzaldehyde

Description:

2-[2-(4-Morpholinyl)ethyl]benzaldehyde, with the CAS number 736991-24-5, is an organic compound characterized by its benzaldehyde functional group attached to a 2-(4-morpholinyl)ethyl side chain. This compound features a morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom, contributing to its unique chemical properties. The presence of the benzaldehyde moiety indicates that it can participate in various chemical reactions typical of aldehydes, such as nucleophilic addition and condensation reactions. Additionally, the morpholine group may impart solubility in polar solvents and influence the compound's biological activity, making it of interest in medicinal chemistry. The compound's structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 2-[2-(4-Morpholinyl)ethyl]benzaldehyde is a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₁₃H₁₇NO₂

InChI: InChI=1S/C13H17NO2/c15-11-13-4-2-1-3-12(13)5-6-14-7-9-16-10-8-14/h1-4,11H,5-10H2

InChI key: InChIKey=OTHSRGCJMVWKNF-UHFFFAOYSA-N

SMILES: C(CN1CCOCC1)C2=C(C=O)C=CC=C2

Synonyms:

• 2-[2-(4-Morpholinyl)ethyl]benzaldehyde
• Benzaldehyde, 2-[2-(4-morpholinyl)ethyl]-