CAS 736991-35-8
:3-fluoro-2-morpholino-benzaldehyde
Description:
3-Fluoro-2-morpholino-benzaldehyde is an organic compound characterized by the presence of a benzaldehyde functional group, a morpholine ring, and a fluorine atom attached to the aromatic ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane. The presence of the morpholine moiety contributes to its potential as a building block in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The fluorine atom can enhance the compound's lipophilicity and metabolic stability, making it a valuable feature in drug design. Additionally, the compound may exhibit interesting reactivity due to the aldehyde functional group, allowing for further chemical modifications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 3-fluoro-2-morpholino-benzaldehyde is a versatile compound with potential applications in various fields, including organic synthesis and medicinal chemistry.
Formula:C11H12FNO2
InChI:InChI=1/C11H12FNO2/c12-10-3-1-2-9(8-14)11(10)13-4-6-15-7-5-13/h1-3,8H,4-7H2
SMILES:c1cc(C=O)c(c(c1)F)N1CCOCC1
Synonyms:- Benzaldehyde, 3-fluoro-2-(4-morpholinyl)-
- 3-fluoro-2-morpholin-4-ylbenzaldehyde
- 3-Fluoro-2-morpholinobenzaldehyde
- 3-FLUORO-2-(N-MORPHOLINO)-BENZALDEHYDE
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
