
CAS 736991-87-0
:2-(2-Fluorophenyl)-4-pyridinecarbonitrile
Description:
2-(2-Fluorophenyl)-4-pyridinecarbonitrile, with the CAS number 736991-87-0, is an organic compound characterized by its unique structural features, which include a pyridine ring and a fluorophenyl group. This compound typically exhibits a molecular structure that includes a cyano group (-C≡N) attached to the pyridine ring, contributing to its reactivity and potential applications in various chemical reactions. The presence of the fluorine atom in the phenyl group can influence the compound's electronic properties, making it potentially useful in medicinal chemistry and material science. The compound may exhibit moderate to high solubility in organic solvents, depending on the specific conditions, and its stability can be influenced by environmental factors such as temperature and pH. Additionally, due to its structural characteristics, it may engage in hydrogen bonding and other intermolecular interactions, which can affect its behavior in biological systems or when used as a reagent in synthetic chemistry. Overall, 2-(2-Fluorophenyl)-4-pyridinecarbonitrile is a compound of interest for further research and application in various fields.
Formula:C12H7FN2
InChI:InChI=1S/C12H7FN2/c13-11-4-2-1-3-10(11)12-7-9(8-14)5-6-15-12/h1-7H
InChI key:InChIKey=JKVJELLGTIQRGQ-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC(C#N)=CC=N2)C=CC=C1
Synonyms:- 2-(2-Fluorophenyl)isonicotinonitrile
- 2-(2-Fluorophenyl)-4-pyridinecarbonitrile
- 4-Pyridinecarbonitrile, 2-(2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.