CAS 737-52-0
:Oxypeucedanin
Description:
Oxypeucedanin is a naturally occurring coumarin compound, primarily found in various plants, particularly in the Apiaceae family. It is characterized by its chemical structure, which includes a fused benzene and α-pyrone ring system, contributing to its biological activity. This compound is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial effects. Oxypeucedanin has been studied for its role in traditional medicine and its potential therapeutic applications. It is typically a colorless to pale yellow crystalline solid, with a relatively low solubility in water but higher solubility in organic solvents. The compound's stability and reactivity can be influenced by environmental factors such as light and temperature. As with many natural products, the extraction and purification processes can affect its yield and purity, making analytical techniques essential for characterization. Overall, oxypeucedanin represents a significant area of interest in both natural product chemistry and pharmacology due to its diverse biological activities.
Formula:C16H14O5
InChI:InChI=1/C16H14O5/c1-16(2)14(21-16)8-19-12-7-15(17)20-13-6-11-9(3-4-18-11)5-10(12)13/h3-7,14H,8H2,1-2H3
SMILES:CC1(C)C(COc2cc(=O)oc3cc4c(cco4)cc23)O1
Synonyms:- Oxypeucadanin
- Oxypeucedarin
- 7H-Furo(3,2-g)(1)benzopyran-7-one, 4-((3,3-dimethyloxiranyl)methoxy)-
- 4-[(3,3-dimethyloxiran-2-yl)methoxy]-7H-furo[3,2-g]chromen-7-one
- 5-[(3,3-dimethyloxiran-2-yl)methoxy]-7H-furo[3,2-g]chromen-7-one
- 4-[(3,3-dimethyloxiran-2-yl)methoxy]furo[3,2-g]chromen-7-one
- 4-(3,3-Dimethyloxiran-2-ylmethoxy)-7H-furo[3,2-g][1]benzopyran-7-one
- 4-(3,3-Dimethylglycidyloxy)-7H-furo[3,2-g][1]benzopyran-7-one
- OXYPEUCEDANIN USP/EP/BP
- 4-[(3,3-Dimethyloxiranyl)methoxy]-7H-furo[3,2-g][1]benzopyran-7-one
- 7H-Furo[3,2-g][1]benzopyran-7-one, 4-[(3,3-dimethyl-2-oxiranyl)methoxy]-
- Oxypeucedanin, 98%, from Angelica biserrata (Shan & C. Q. Yuan) C. Q. Yuan & Shan
- Oxypencedanin
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Oxypeucedanin
CAS:Oxypeucedanin is a major coumarin aglycone that can be extracted from Ostericum koreanum, coumarin aglycones have demonstrated various pharmacological effects, including anti-proliferation, anti-inflammation, and anti-pain; based on transcriptional alteration and complicated modulation of MAPK signaling, might be underlying mechanisms responsible for the various pharmacological effects of oxypeucedanin.Formula:C16H14O5Purity:95%~99%Molecular weight:286.283Oxypeucedanin
CAS:1.Formula:C16H14O5Purity:98.66% - 98.85%Color and Shape:SolidMolecular weight:286.28Oxypeucedanin
CAS:LactoneFormula:C16H14O5Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:286.28Oxypeucedanin
CAS:Oxypeucedanin is a furanocoumarin compound, which is derived from various plant sources, most notably those in the Apiaceae family such as Peucedanum and Angelica species. It functions primarily as a photoreactive agent, capable of interacting with DNA under ultraviolet (UV) light through a process called photoactivation. Upon UV exposure, it forms covalent bonds with DNA, leading to cross-linking that can disrupt cellular functions.Formula:C16H14O5Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:286.28 g/mol






