CAS 737-76-8
:9-(5-deoxy-5-triaza-1,2-dien-2-ium-1-ylpentofuranosyl)-9H-purin-6-amine
Description:
The chemical substance known as "9-(5-deoxy-5-triaza-1,2-dien-2-ium-1-ylpentofuranosyl)-9H-purin-6-amine," with the CAS number 737-76-8, is a purine derivative that features a unique structural framework combining a purine base with a modified sugar moiety. This compound is characterized by the presence of a triaza group, which introduces nitrogen atoms into the structure, enhancing its potential biological activity. The pentofuranosyl component indicates that the sugar is a five-membered ring, which is typical for nucleosides. The presence of amino groups in the purine structure suggests that this compound may participate in various biochemical processes, potentially acting as a nucleoside analog. Such compounds are often of interest in medicinal chemistry and biochemistry due to their roles in nucleic acid metabolism and potential therapeutic applications. The specific arrangement of atoms and functional groups in this molecule contributes to its unique properties, influencing its solubility, stability, and interaction with biological targets.
Formula:C10H13N8O3
InChI:InChI=1/C10H13N8O3/c11-8-5-9(14-2-13-8)18(3-15-5)10-7(20)6(19)4(21-10)1-16-17-12/h2-4,6-7,10,12,19-20H,1H2,(H2,11,13,14)/q+1
SMILES:C(C1C(C(C(n2cnc3c(N)ncnc23)O1)O)O)NN=N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5'-Azido-5'-deoxyadenosine
CAS:5'-Azido-5'-deoxyadenosine is a purine nucleoside analogue, inhibit Trichomonas vaginalis and PRMT5 , click chemistry alkyne, DBCO, or BCN groups.Formula:C10H12N8O3Purity:99.84%Color and Shape:SolidMolecular weight:292.255'-Azido-5'-deoxyadenosine
CAS:5'-Azido-5'-deoxyadenosine (Aza-dA) is an adenosine analog that inhibits the deamination of S-adenosylhomocysteine to form adenosine. It has been shown to be more potent than 2-chloroadenosine and inactivates the enzyme s-adenosylhomocysteine hydrolase, which is responsible for the conversion of S-adenosylhomocysteine to adenosine. This leads to decreased levels of adenosine and increased levels of s-adensoylhomocysteine. Aza-dA has been shown to inhibit tumor growth and induce apoptosis in rat hepatocytes. In addition, it is a halogenated molecule that can be used as a modifying agent.Formula:C10H12N8O3Purity:Min. 95%Color and Shape:PowderMolecular weight:292.25 g/mol


