CAS 737-86-0
:Pyridoxal isonicotinoyl hydrazone
Description:
Pyridoxal isonicotinoyl hydrazone (CAS 737-86-0) is a chemical compound that serves as a ligand and has been studied for its potential biological activities, particularly in the context of metal ion chelation. It is derived from pyridoxal, a form of vitamin B6, and isonicotinic acid hydrazone, which contributes to its structural properties. This compound is characterized by its ability to form stable complexes with transition metals, which can influence various biochemical pathways. Pyridoxal isonicotinoyl hydrazone exhibits properties such as antioxidant activity and potential neuroprotective effects, making it of interest in pharmacological research. Its solubility and stability in different solvents can vary, impacting its application in biological systems. Additionally, the compound's structure allows for interactions with biological macromolecules, which may facilitate its role in therapeutic contexts. Overall, pyridoxal isonicotinoyl hydrazone represents a significant area of study in medicinal chemistry and biochemistry due to its unique properties and potential health benefits.
Formula:C14H14N4O3
InChI:InChI=1/C14H14N4O3/c1-9-13(20)12(11(8-19)6-16-9)7-17-18-14(21)10-2-4-15-5-3-10/h2-7,17,19H,8H2,1H3,(H,18,21)/b12-7-
InChI key:InChIKey=BQYIXOPJPLGCRZ-UHFFFAOYSA-N
SMILES:C(=NNC(=O)C=1C=CN=CC1)C=2C(CO)=CN=C(C)C2O
Synonyms:- Isonicotinic acid, hydrazide, hydrazone with pyridoxal
- 4-Pyridinecarboxylic acid, [[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylene]hydrazide
- 4-Pyridinecarboxylic acid, 2-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylene]hydrazide
- Pyridoxal isonicotinoyl hydrazone
- Isonicotinic acid, [[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridyl]methylene]hydrazide
- PIH - CAS 737-86-0 - Calbiochem
- Pyridoxal isonicotinoyl hydrazone (PIH)
- Pyridoxal isonicotinoyl hydrazine
- PIH(Pyridoxal isonicotinoyl hydrazine)
- NSC 77674
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Pyridoxal isonicotinoyl hydrazone
CAS:Formula:C14H14N4O3Purity:98%Color and Shape:SolidMolecular weight:286.2860N'-((3-Hydroxy-5-(Hydroxymethyl)-2-Methylpyridin-4-Yl)Methylene)Isonicotinohydrazide
CAS:N'-((3-Hydroxy-5-(Hydroxymethyl)-2-Methylpyridin-4-Yl)Methylene)IsonicotinohydrazidePurity:98%Molecular weight:286.29g/molpyridoxal isonicotinoyl hydrazone
CAS:pyridoxal isonicotinoyl hydrazonePurity:≥98%Molecular weight:286.29g/molPyridoxal Isonicotinoyl Hydrazone
CAS:Formula:C14H14N4O3Purity:>95.0%(T)(HPLC)Color and Shape:White to Light orange to Pale yellow green powder to crystalMolecular weight:286.29pyridoxal isonicotinoyl hydrazone
CAS:pyridoxal isonicotinoyl hydrazone (PIH) is a cell-permeable and relatively non-toxic iron (Fe3+) chelator that shows high iron chelation efficacy.Formula:C14H14N4O3Purity:99.74%Color and Shape:SolidMolecular weight:286.29Pyridoxal Isonicotinoyl Hydrazone
CAS:Controlled ProductFormula:C14H14N4O3Color and Shape:NeatMolecular weight:286.29




