CAS 7370-49-2
:13,16-Docosadienoic acid
Description:
13,16-Docosadienoic acid, also known as behenic acid, is a long-chain unsaturated fatty acid characterized by its 22 carbon atoms and two double bonds located at the 13th and 16th positions from the carboxylic acid end. This fatty acid is part of the omega-9 family and is typically found in various plant oils and animal fats. It is a colorless to pale yellow liquid at room temperature and is insoluble in water but soluble in organic solvents. The presence of double bonds contributes to its reactivity, making it useful in various chemical applications, including the synthesis of surfactants and emulsifiers. Additionally, 13,16-docosadienoic acid is of interest in nutritional studies due to its potential health benefits, including anti-inflammatory properties. Its molecular structure allows it to participate in various biochemical pathways, influencing lipid metabolism and cellular functions. Overall, this fatty acid plays a significant role in both industrial applications and biological systems.
Formula:C22H40O2
InChI:InChI=1S/C22H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h6-7,9-10H,2-5,8,11-21H2,1H3,(H,23,24)
InChI key:InChIKey=HVGRZDASOHMCSK-UHFFFAOYSA-N
SMILES:C(CCCCC=CCC=CCCCCC)CCCCCCC(O)=O
Synonyms:- 13,16-Docosadienoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
