CAS 737000-76-9
:3,5-Difluoro-2-methoxybenzeneboronic acid
Description:
3,5-Difluoro-2-methoxybenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a substituted aromatic ring. The molecular structure features two fluorine atoms at the 3 and 5 positions of the benzene ring, which can influence its electronic properties and reactivity. The methoxy group at the 2 position enhances the solubility and stability of the compound in various solvents. This compound is typically used in organic synthesis, particularly in cross-coupling reactions such as Suzuki-Miyaura coupling, which is valuable in the formation of carbon-carbon bonds. The presence of the boronic acid group allows for the formation of stable complexes with diols, making it useful in various applications, including medicinal chemistry and materials science. Additionally, the fluorine substituents can impart unique properties, such as increased lipophilicity and altered biological activity. Overall, 3,5-Difluoro-2-methoxybenzeneboronic acid is a versatile compound with significant utility in synthetic organic chemistry.
Formula:C7H7BF2O3
InChI:InChI=1/C7H7BF2O3/c1-13-7-5(8(11)12)2-4(9)3-6(7)10/h2-3,11-12H,1H3
SMILES:COc1c(cc(cc1F)F)B(O)O
Synonyms:- (3,5-Difluoro-2-Methoxyphenyl)Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Difluoro-2-methoxybenzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H7BF2O3Purity:97%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:187.94(3,5-Difluoro-2-methoxyphenyl)boronic acid
CAS:Formula:C7H7BF2O3Purity:97%Color and Shape:SolidMolecular weight:187.93653,5-Difluoro-2-methoxybenzeneboronic acid
CAS:3,5-Difluoro-2-methoxybenzeneboronic acidPurity:96%Color and Shape:White PowderMolecular weight:187.94g/mol



