CAS 737000-84-9
:(1S)-2,3-Dihydro-1-isothiocyanato-1H-indene
Description:
(1S)-2,3-Dihydro-1-isothiocyanato-1H-indene is a chemical compound characterized by its unique structure, which includes an indene core with a dihydro configuration and an isothiocyanate functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the isothiocyanate group imparts notable reactivity, making it useful in various chemical reactions, particularly in the synthesis of other organic compounds. It may exhibit biological activity, which can be of interest in medicinal chemistry and agrochemicals. The stereochemistry indicated by the (1S) designation suggests specific spatial arrangements of atoms, which can influence its reactivity and interactions with biological systems. As with many isothiocyanates, it may possess pungent odors and potential applications in the development of pharmaceuticals or as a chemical intermediate. Safety data should be consulted for handling and storage, as isothiocyanates can be irritants and may pose health risks.
Formula:C10H9NS
InChI:InChI=1S/C10H9NS/c12-7-11-10-6-5-8-3-1-2-4-9(8)10/h1-4,10H,5-6H2/t10-/m0/s1
InChI key:InChIKey=YQGGEOQEFFXRLO-JTQLQIEISA-N
SMILES:N(=C=S)[C@@H]1C=2C(CC1)=CC=CC2
Synonyms:- 1H-Indene, 2,3-dihydro-1-isothiocyanato-, (1S)-
- (1S)-2,3-Dihydro-1-isothiocyanato-1H-indene
- (s)-(+)-1-Indanyl isothiocyanate
- (1S)-1-Isothiocyanato-2,3-dihydro-1H-indene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
