CAS 737000-85-0
:(2R)-2-Isothiocyanatononane
Description:
(2R)-2-Isothiocyanatononane is an organic compound characterized by the presence of an isothiocyanate functional group attached to a nonane backbone. This compound features a chiral center at the second carbon, which contributes to its stereochemistry, specifically the (2R) configuration. Isothiocyanates are known for their pungent odor and are often associated with the characteristic smell of mustard and horseradish. They are typically formed through the reaction of thiocyanates with alkyl halides or by the degradation of glucosinolates in plants. (2R)-2-Isothiocyanatononane may exhibit biological activity, including potential antimicrobial and anticancer properties, making it of interest in medicinal chemistry and agricultural applications. Its physical properties, such as boiling point and solubility, can vary based on the length of the carbon chain and the presence of functional groups. As with many isothiocyanates, it may also undergo hydrolysis to form corresponding thioureas or other derivatives under certain conditions. Safety precautions should be taken when handling this compound due to its potential irritant properties.
Formula:C10H19NS
InChI:InChI=1S/C10H19NS/c1-3-4-5-6-7-8-10(2)11-9-12/h10H,3-8H2,1-2H3/t10-/m1/s1
InChI key:InChIKey=MQPOQQFZEYBCRM-SNVBAGLBSA-N
SMILES:[C@@H](CCCCCCC)(N=C=S)C
Synonyms:- (2R)-2-Isothiocyanatononane
- Nonane, 2-isothiocyanato-, (2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
