CymitQuimica logo

CAS 737000-86-1

:

(2S)-2-Isothiocyanatononane

Description:
(2S)-2-Isothiocyanatononane is an organic compound characterized by the presence of an isothiocyanate functional group, which is known for its distinctive sulfur-containing structure. This compound features a nonane backbone, indicating it has a total of nine carbon atoms, with the isothiocyanate group (-N=C=S) attached to the second carbon in a specific stereochemical configuration (S). Isothiocyanates are typically derived from glucosinolates and are recognized for their pungent odors and potential biological activities, including antimicrobial and anticancer properties. The presence of the isothiocyanate group also suggests that this compound may exhibit reactivity towards nucleophiles, making it useful in various synthetic applications. Additionally, the stereochemistry of (2S)-2-Isothiocyanatononane may influence its biological activity and interaction with other molecules. Overall, this compound represents a class of chemicals that are of interest in both synthetic organic chemistry and biological research due to their unique properties and potential applications.
Formula:C10H19NS
InChI:InChI=1S/C10H19NS/c1-3-4-5-6-7-8-10(2)11-9-12/h10H,3-8H2,1-2H3/t10-/m0/s1
InChI key:InChIKey=MQPOQQFZEYBCRM-JTQLQIEISA-N
SMILES:[C@H](CCCCCCC)(N=C=S)C
Synonyms:
  • (2S)-2-Isothiocyanatononane
  • Nonane, 2-isothiocyanato-, (2S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.