CymitQuimica logo

CAS 737000-88-3

:

Pyridine, 2,4-dibromo-, hydrobromide (1:1)

Description:
Pyridine, 2,4-dibromo-, hydrobromide (1:1) is a chemical compound characterized by its pyridine ring structure substituted with bromine atoms at the 2 and 4 positions. This compound is typically encountered as a hydrobromide salt, indicating that it is associated with hydrobromic acid, which enhances its solubility in polar solvents. Pyridine derivatives are known for their aromatic properties and can exhibit basicity due to the nitrogen atom in the ring. The presence of bromine substituents can influence the compound's reactivity, making it useful in various chemical synthesis applications, including the production of pharmaceuticals and agrochemicals. Additionally, the hydrobromide form may enhance the stability and handling of the compound. Safety considerations are important, as brominated compounds can be hazardous, and appropriate precautions should be taken when handling this substance. Overall, 2,4-dibromopyridine hydrobromide is a valuable compound in organic chemistry with specific applications in research and industry.
Formula:C5H3Br2N.BrH
InChI:InChI=1S/C5H3Br2N.BrH/c6-4-1-2-8-5(7)3-4;/h1-3H;1H
InChI key:InChIKey=XBRWTQPOFHBDIK-UHFFFAOYSA-N
SMILES:BrC=1C=C(Br)N=CC1.Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.