CAS 737000-90-7
:[[[(1R,2R)-2-Isothiocyanatocyclopentyl]oxy]methyl]benzene
Description:
The chemical substance known as [[[(1R,2R)-2-Isothiocyanatocyclopentyl]oxy]methyl]benzene, with the CAS number 737000-90-7, is characterized by its unique structural features that include a benzene ring substituted with a methylene group linked to a cyclopentyl moiety, which is further substituted with an isothiocyanate functional group. This compound exhibits properties typical of isothiocyanates, such as potential biological activity, including antimicrobial and anticancer effects, due to the presence of the isothiocyanate group. The cyclopentyl structure contributes to its steric and electronic properties, influencing its reactivity and interaction with biological targets. Additionally, the presence of the benzene ring suggests potential for π-π stacking interactions, which may enhance its solubility and stability in various solvents. Overall, this compound's unique combination of functional groups and structural characteristics makes it of interest in medicinal chemistry and material science, although specific applications and biological activities would require further investigation.
Formula:C13H15NOS
InChI:InChI=1S/C13H15NOS/c16-10-14-12-7-4-8-13(12)15-9-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-9H2/t12-,13-/m1/s1
InChI key:InChIKey=XPXSISUCDSDZAB-CHWSQXEVSA-N
SMILES:O(CC1=CC=CC=C1)[C@H]2[C@H](N=C=S)CCC2
Synonyms:- Benzene, [[[(1R,2R)-2-isothiocyanatocyclopentyl]oxy]methyl]-
- [[[(1R,2R)-2-Isothiocyanatocyclopentyl]oxy]methyl]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
