CAS 737000-97-4
:(1R)-2,3-Dihydro-1-isothiocyanato-1H-indene
Description:
(1R)-2,3-Dihydro-1-isothiocyanato-1H-indene, with the CAS number 737000-97-4, is a chemical compound characterized by its unique structure, which includes an indene core and an isothiocyanate functional group. This compound typically exhibits a molecular formula that reflects its composition of carbon, hydrogen, nitrogen, and sulfur atoms. The presence of the isothiocyanate group suggests potential reactivity, particularly in nucleophilic addition reactions, and may impart biological activity, making it of interest in medicinal chemistry and agrochemical applications. The stereochemistry indicated by the (1R) designation suggests specific spatial arrangements of atoms, which can influence the compound's physical and chemical properties, such as solubility, boiling point, and reactivity. Additionally, the dihydro configuration indicates that the compound has undergone partial hydrogenation, affecting its stability and interaction with other molecules. Overall, this compound's characteristics make it a subject of interest for further research in various chemical and biological contexts.
Formula:C10H9NS
InChI:InChI=1S/C10H9NS/c12-7-11-10-6-5-8-3-1-2-4-9(8)10/h1-4,10H,5-6H2/t10-/m1/s1
InChI key:InChIKey=YQGGEOQEFFXRLO-SNVBAGLBSA-N
SMILES:N(=C=S)[C@H]1C=2C(CC1)=CC=CC2
Synonyms:- (r)-(-)-1-Indanyl isothiocyanate
- 1H-Indene, 2,3-dihydro-1-isothiocyanato-, (1R)-
- (1R)-2,3-Dihydro-1-isothiocyanato-1H-indene
- (1R)-1-Isothiocyanato-2,3-dihydro-1H-indene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
