CAS 737003-45-1
:1-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol
Description:
1-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol, with the CAS number 737003-45-1, is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features a hydroxyl group (-OH) at the 5-position of the pyrrolo ring, contributing to its potential as a bioactive molecule. The presence of the methyl group at the 1-position enhances its lipophilicity, which may influence its solubility and interaction with biological systems. The compound is of interest in medicinal chemistry due to its structural similarity to various pharmacologically active compounds, potentially exhibiting neuroprotective or anti-inflammatory properties. Its unique structure allows for various synthetic modifications, making it a candidate for further research in drug development. Additionally, the compound's stability and reactivity can be influenced by the electronic properties of the nitrogen atoms in the heterocyclic rings, which may affect its behavior in chemical reactions and interactions with other molecules. Overall, 1-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol represents a significant area of study in organic and medicinal chemistry.
Formula:C8H8N2O
InChI:InChI=1/C8H8N2O/c1-10-3-2-6-4-7(11)5-9-8(6)10/h2-5,11H,1H3
SMILES:Cn1ccc2cc(cnc12)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol
CAS:Formula:C8H8N2OColor and Shape:SolidMolecular weight:148.1619
