CAS 7372-30-7
:3-O-Acetylursolic acid
Description:
3-O-Acetylursolic acid is a naturally occurring triterpenoid compound derived from various plants, particularly those in the Lamiaceae family. It is characterized by its structural features, which include a pentacyclic triterpene skeleton with an acetyl group at the 3-position of the ursolic acid structure. This modification enhances its solubility and bioactivity. The compound exhibits a range of biological activities, including anti-inflammatory, antioxidant, and anticancer properties, making it of interest in pharmacological research. Its mechanism of action often involves modulation of various signaling pathways and gene expression. Additionally, 3-O-acetylursolic acid has been studied for its potential effects on metabolic disorders and its ability to promote apoptosis in cancer cells. The compound is typically isolated from plant sources and can be synthesized in the laboratory, contributing to its availability for research and potential therapeutic applications. As with many natural products, its efficacy and safety profile are subjects of ongoing investigation.
Formula:C32H50O4
InChI:InChI=1S/C32H50O4/c1-19-11-16-32(27(34)35)18-17-30(7)22(26(32)20(19)2)9-10-24-29(6)14-13-25(36-21(3)33)28(4,5)23(29)12-15-31(24,30)8/h9,19-20,23-26H,10-18H2,1-8H3,(H,34,35)/t19-,20+,23+,24-,25+,26+,29+,30-,31-,32+/m1/s1
InChI key:InChIKey=PHFUCJXOLZAQNH-OTMOLZNZSA-N
SMILES:C[C@]12[C@@]3(C)C([C@]4([C@@](C(O)=O)(CC3)CC[C@@H](C)[C@@H]4C)[H])=CC[C@@]1([C@]5(C)[C@@](CC2)(C(C)(C)[C@@H](OC(C)=O)CC5)[H])[H]
Synonyms:- (17Xi,18Xi)-3-(Acetyloxy)Urs-12-En-28-Oic Acid
- (3beta)-3-(Acetyloxy)-urs-12-en-28-oic acid
- (3β)-3-(Acetyloxy)urs-12-en-28-oic acid
- 3-Acetylursolic acid
- 3-O-Acetylursolic acid
- Acetylursolic acid
- Urs-12-en-28-oic acid, 3-(acetyloxy)-, (3β)-
- Urs-12-en-28-oic acid, 3β-hydroxy-, acetate
- Ursolic acetate
- Ursolic acid 3-O-acetate
- Ursolic acid 3-acetate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-acetylursolic acid
CAS:Acetylursolic acid shows significant cytotoxic activities, and shows suppression of the SOS-inducing activity of mutagenic heterocyclic amine, Trp-P-1. 3β-Acetylursolic acid can reduce parasitaemia against Plasmodium berghei.Formula:C32H50O4Purity:95%~99%Color and Shape:PowderMolecular weight:498.748Ursolic acid acetate
CAS:Ursolic acid acetate (Acetylursolic acid) has cytotoxic activity, antimalarial activity, antitumor and anticancer activities.Formula:C32H50O4Purity:98.3% - ≥95%Color and Shape:SolidMolecular weight:498.74Ursolic acid acetate
CAS:Ursolic acid acetate is a natural triterpenoid compound, which is derived from the acetylation of ursolic acid. This compound is sourced from a variety of medicinal plants, including apples, rosemary, and holy basil. Its mode of action involves modulating multiple cellular pathways, including the inhibition of nuclear factor-kappa B (NF-κB) and the activation of AMP-activated protein kinase (AMPK). These actions contribute to its anti-inflammatory, anticancer, and antioxidant properties.
Formula:C32H50O4Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:498.74 g/mol





