CAS 7372-85-2

2,5-dimethylbiphenyl

Description:

2,5-Dimethylbiphenyl, with the CAS number 7372-85-2, is an organic compound belonging to the biphenyl family, characterized by the presence of two phenyl rings connected by a single bond. This compound features two methyl groups attached to the 2 and 5 positions of one of the phenyl rings, which influences its physical and chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature, and exhibits a relatively high boiling point and melting point compared to many other organic compounds. 2,5-Dimethylbiphenyl is known for its hydrophobic nature, making it insoluble in water but soluble in organic solvents. It has applications in organic synthesis and as a potential intermediate in the production of various chemicals. Additionally, it may be studied for its thermal stability and potential use in materials science. Safety data indicates that, like many organic compounds, it should be handled with care to avoid inhalation or skin contact.

Formula: C₁₄H₁₄

InChI: InChI=1/C14H14/c1-11-8-9-12(2)14(10-11)13-6-4-3-5-7-13/h3-10H,1-2H3

SMILES: Cc1ccc(C)c(c1)c1ccccc1

Synonyms:

• 1,1'-Biphenyl, 2,5-Dimethyl-