CAS 7372-87-4
:1,8-dimethylphenanthrene
Description:
1,8-Dimethylphenanthrene is a polycyclic aromatic hydrocarbon (PAH) characterized by its fused ring structure, which consists of three fused benzene rings with two methyl groups attached at the 1 and 8 positions. This compound is typically a solid at room temperature and exhibits a high melting point, indicative of its stable aromatic structure. It is insoluble in water but soluble in organic solvents, which is a common trait among PAHs. 1,8-Dimethylphenanthrene is known for its potential environmental persistence and can be found in fossil fuels and as a byproduct of combustion processes. Its structure contributes to its chemical reactivity, particularly in terms of electrophilic substitution reactions. Additionally, like many PAHs, it may pose health risks due to its mutagenic and carcinogenic properties, necessitating careful handling and regulation. The compound is often studied in the context of environmental chemistry and toxicology, as well as in the development of materials and organic electronics.
Formula:C16H14
InChI:InChI=1/C16H14/c1-11-5-3-7-15-13(11)9-10-14-12(2)6-4-8-16(14)15/h3-10H,1-2H3
Synonyms:- phenanthrene, 1,8-dimethyl-
- 1,8-DIMETHYLPHENANTHRENE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
