CAS 73721-29-6

6-Chloro-2-methylimidazo[1,2-b]pyridazin-3-amine

Description:

6-Chloro-2-methylimidazo[1,2-b]pyridazin-3-amine is a heterocyclic organic compound characterized by its complex structure, which includes both imidazole and pyridazine rings. This compound features a chlorine atom and a methyl group attached to the imidazo ring, contributing to its unique chemical properties. It is typically a crystalline solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of nitrogen atoms in its structure. The compound is of interest in medicinal chemistry and research due to its potential biological activities, including antitumor properties. Its reactivity can be influenced by the presence of the chlorine substituent, which may participate in electrophilic substitution reactions. Additionally, the compound's stability and behavior under various conditions can be affected by factors such as pH and temperature. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, making it a subject of study in the fields of organic synthesis and pharmacology.

Formula: C₇H₇ClN₄

InChI: InChI=1S/C7H7ClN4/c1-4-7(9)12-6(10-4)3-2-5(8)11-12/h2-3H,9H2,1H3

InChI key: InChIKey=CTATXGIZGQZTSA-UHFFFAOYSA-N

SMILES: NC=1N2C(=NC1C)C=CC(Cl)=N2

Synonyms:

• 6-Chloro-2-methylimidazo[1,2-b]pyridazin-3-amine
• Imidazo[1,2-b]pyridazin-3-amine, 6-chloro-2-methyl-