CAS 73724-43-3
:3-[(1,1-Dimethylethyl)dithio]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-alanine
Description:
3-[(1,1-Dimethylethyl)dithio]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-alanine, with the CAS number 73724-43-3, is a synthetic compound primarily used in peptide synthesis and as a protecting group in organic chemistry. This compound features a dithio group, which enhances its stability and reactivity, making it useful in various chemical reactions. The presence of the fluorenylmethoxycarbonyl (Fmoc) group indicates its role as a protecting group for the amino acid L-alanine, allowing for selective reactions without interfering with the amino or carboxyl functionalities. The bulky tert-butyl dithio moiety contributes to steric hindrance, which can influence the compound's reactivity and solubility. Overall, this compound is characterized by its complex structure, which combines elements of both organic and organosilicon chemistry, making it valuable in the synthesis of peptides and other organic compounds. Its unique properties allow for specific applications in research and development within the fields of biochemistry and medicinal chemistry.
Formula:C22H25NO4S2
InChI:InChI=1S/C22H25NO4S2/c1-22(2,3)29-28-13-19(20(24)25)23-21(26)27-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,12-13H2,1-3H3,(H,23,26)(H,24,25)/t19-/m0/s1
InChI key:InChIKey=ZDUMTHLUTJOUML-IBGZPJMESA-N
SMILES:C(OC(N[C@@H](CSSC(C)(C)C)C(O)=O)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:- (2R)-3-(tert-Butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid
- 3-(tert-butyldisulfanyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-alanine
- 3-[(1,1-Dimethylethyl)dithio]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-<span class="text-smallcaps">L</span>-alanine
- <span class="text-smallcaps">L</span>-Alanine, 3-[(1,1-dimethylethyl)dithio]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-
- Fmoc-Cys(StBu)-OH
- Fmoc-Cys(tButhio)-OH
- N-α-Fmoc-S-t-butylthio-<span class="text-smallcaps">L</span>-cysteine
- L-Alanine, 3-[(1,1-dimethylethyl)dithio]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-
- 3-[(1,1-Dimethylethyl)dithio]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-alanine
- N-α-Fmoc-S-t-butylthio-L-cysteine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Fmoc-Cys(StBu)-OH
CAS:Was converted into the corresponding N-Me-Cys derivative in excellent yield. Educt for obtaining the Cys 4-methyl-2,6,7-trioxabicyclo[2,2,2]octyl (OBO) orthoester. The OBO ester was attached to a thiol resin as disulfide for obtaining peptides containing a C-terminal cysteine.Formula:C22H25NO4S2Purity:99.4%Color and Shape:White PowderMolecular weight:431.58(R)-2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(TERT-BUTYLDISULFANYL)PROPANOIC ACID
CAS:Formula:C22H25NO4S2Purity:97%Color and Shape:SolidMolecular weight:431.5682Ref: IN-DA003QN0
1g46.00€5g108.00€10g195.00€25g337.00€50gTo inquire100gTo inquire100mg21.00€250mg25.00€Fmoc-Cys(StBu)-OH
CAS:Formula:C22H25NO4S2Purity:(HPLC) ≥ 98.0%Color and Shape:White to off-white or faint beige powderMolecular weight:431.57N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-S-(tert-butylthio)-L-cysteine
CAS:Purity:97%Molecular weight:431.5700073Fmoc-L-Cys(StBu)-OH
CAS:Fmoc-L-Cys(StBu)-OH is a synthetic molecule that is used in pharmaceutical formulations. It can be synthesized from Fmoc-L-Cys and L-serine methyl ester by the chemical ligation of the two molecules. The chloride group at the end of this molecule provides a functional group for conjugation with other biomolecules, such as fatty acids. This molecule has been shown to have high purity with an isolated yield of about 98%.
Formula:C22H25NO4S2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:431.57 g/molRef: 3D-FF41067
Discontinued product





