CAS 73728-45-7
:N',2-dihydroxyethanimidamide
Description:
N',2-dihydroxyethanimidamide, with the CAS number 73728-45-7, is a chemical compound characterized by its amide functional group and two hydroxyl groups attached to the ethanimidamide backbone. This compound typically exhibits properties associated with both amides and alcohols, such as potential solubility in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The structure suggests that it may participate in various chemical reactions, including those typical of amides, such as hydrolysis or condensation reactions. Additionally, the hydroxyl groups may enhance its reactivity and interaction with biological systems, making it of interest in medicinal chemistry and biochemistry. The compound's stability, reactivity, and potential applications would depend on its specific molecular interactions and the environment in which it is used. As with many organic compounds, safety data and handling precautions should be considered, especially in laboratory settings.
Formula:C2H6N2O2
InChI:InChI=1/C2H6N2O2/c3-2(1-5)4-6/h5-6H,1H2,(H2,3,4)
SMILES:C(C(=N)NO)O
Synonyms:- (1Z)-N',2-Dihydroxyethanimidamide
- ethanimidamide, N',2-dihydroxy-, (1Z)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(1E)-N',2-Dihydroxyethanimidamide
CAS:(1E)-N',2-Dihydroxyethanimidamide (DHEEA) is a versatile building block in organic synthesis. It is an important intermediate in the synthesis of various drugs, such as metoprolol, amlodipine, and clomiphene. DHEEA is also used as a reagent in organic chemistry for the preparation of other compounds and as a research chemical. The compound has CAS No. 73728-45-7 and can be purchased from chemical suppliers or synthesized by reacting formaldehyde with ethanolamine.Formula:C2H6N2O2Purity:Min. 95%Color and Shape:White/Off-White SolidMolecular weight:90.08 g/mol
