CAS 73731-87-0: Broussonin A

Description:Broussonin A is a natural compound classified as a triterpenoid, specifically a type of saponin, derived from the Broussonetia plant species. It is known for its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Broussonin A exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it a subject of interest in medicinal chemistry and pharmacology. The compound's mechanism of action often involves modulation of cellular signaling pathways, although specific details may vary based on the context of its use. Additionally, Broussonin A's solubility and stability can be influenced by its structural characteristics, which may affect its bioavailability and therapeutic efficacy. Research into Broussonin A continues to explore its potential applications in drug development and natural product chemistry, highlighting the importance of understanding its chemical properties and biological interactions.

Formula:C₁₆H₁₈O₃

InChI:InChI=1S/C16H18O3/c1-19-15-10-7-13(16(18)11-15)4-2-3-12-5-8-14(17)9-6-12/h5-11,17-18H,2-4H2,1H3

InChI key:InChIKey=MSNVBURPCQDLEP-UHFFFAOYSA-N

SMILES:OC1=CC=C(C=C1)CCCC2=CC=C(OC)C=C2O

Synonyms:
Broussonin A
Phenol, 2-[3-(4-hydroxyphenyl)propyl]-5-methoxy-
2-[3-(4-Hydroxyphenyl)propyl]-5-methoxyphenol

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Broussonin A REF: IN-DA00FEOZCAS: 73731-87-0	97.5%	To inquire	Tue 06 May 25
Broussonin A REF: TM-TN3539CAS: 73731-87-0	98%	To inquire	Mon 05 May 25
Broussonin A REF: BP-SBP02289CAS: 73731-87-0	95%~99%	To inquire	Wed 07 May 25
Broussonin A REF: 3D-YCA73187CAS: 73731-87-0	Min. 95%	To inquire	Tue 17 Jun 25