CAS 73738-04-2

5-(1,1,2,2,2-pentadeuterioethyl)-5-phenyl-2-thioxo-hexahydropyrimidine-4,6-dione

Description:

The chemical substance known as 5-(1,1,2,2,2-pentadeuterioethyl)-5-phenyl-2-thioxo-hexahydropyrimidine-4,6-dione, with the CAS number 73738-04-2, is a synthetic organic compound that belongs to the class of pyrimidine derivatives. It features a hexahydropyrimidine core, which is a saturated six-membered ring containing nitrogen atoms. The presence of a thioxo group (a sulfur atom double-bonded to a carbon atom) contributes to its reactivity and potential biological activity. The compound is also characterized by the presence of a phenyl group and a deuterated ethyl substituent, which can influence its physical and chemical properties, such as solubility and stability. The deuteration may also be significant for studies involving isotopic labeling in biological or chemical research. Overall, this compound may have applications in medicinal chemistry or as a research tool in understanding pyrimidine-related biological processes. However, specific details regarding its biological activity, toxicity, or practical applications would require further investigation.

Formula: C₁₂H₇D₅N₂O₂S

InChI: InChI=1/C12H12N2O2S/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h3-7H,2H2,1H3,(H2,13,14,15,16,17)/i1D3,2D2

SMILES: C(C(C1(c2ccccc2)C(=NC(=S)N=C1O)O)([2H])[2H])([2H])([2H])[2H]

5-Phenyl-5-ethyl-2-thiobarbituric Acid-d5

Controlled Product

CAS: 73738-04-2

Applications Phenobarbital derivative.
References Foltz, R.L., et al.: Biochem. Med., 6, 294 (1972),

Formula: C₁₂₂H₅H₇N₂O₂S

Color and Shape: Neat

Molecular weight: 253.33

Ref: TR-P321342