CAS 7374-79-0: Acanthoside B
Description:Acanthoside B is a natural compound classified as a glycoside, specifically derived from the plant Acanthopanax species. It is known for its potential pharmacological properties, including anti-inflammatory and antioxidant effects. The molecular structure of Acanthoside B features a sugar moiety linked to a non-sugar component, which contributes to its biological activity. This compound has garnered interest in the field of medicinal chemistry due to its potential therapeutic applications, particularly in traditional medicine practices. Acanthoside B is typically studied for its effects on various biological systems, including its influence on cellular signaling pathways. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its bioavailability and efficacy in potential therapeutic contexts. As research continues, Acanthoside B may reveal further insights into its mechanisms of action and possible uses in health and disease management.
Formula:C28H36O13
InChI:InChI=1S/C28H36O13/c1-34-16-5-12(6-17(35-2)21(16)30)25-14-10-39-26(15(14)11-38-25)13-7-18(36-3)27(19(8-13)37-4)41-28-24(33)23(32)22(31)20(9-29)40-28/h5-8,14-15,20,22-26,28-33H,9-11H2,1-4H3/t14-,15-,20+,22+,23-,24+,25+,26+,28-/m0/s1
InChI key:InChIKey=WEKCEGQSIIQPAQ-IRBNZIFYSA-N
SMILES:OC1=C(OC)C=C(C=C1OC)C2OCC3C(OCC23)C4=CC(OC)=C(OC5OC(CO)C(O)C(O)C5O)C(OC)=C4
- Synonyms:
- (+)-Syringaresinol 4′-O-β-glucopyranoside
- (+)-Syringaresinol O-β-<span class="text-smallcaps">D</span>-glucopyranoside
- (+)-Syringaresinol β-<span class="text-smallcaps">D</span>-glucopyranoside
- (+)-Syringaresinol β-<span class="text-smallcaps">D</span>-glucoside
- 1H,3H-Furo[3,4-c]furan, β-<span class="text-smallcaps">D</span>-glucopyranoside deriv.
- 2,6-Dimethoxy-4-[(1S,3aR,4S,6aR)-tetrahydro-4-(4-hydroxy-3,5-dimethoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]phenyl β-<span class="text-smallcaps">D</span>-glucopyranoside
- 4-[(1S,3aR,4S,6aR)-4-(4-hydroxy-3,5-dimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2,6-dimethoxyphenyl beta-D-glucopyranoside
- Acanthoside B
- Eleutheroside E<sub>1</sub>
- Glucopyranoside, 2,6-dimethoxy-4-[tetrahydro-4-(4-hydroxy-3,5-dimethoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]phenyl, β-<span class="text-smallcaps">D</span>-
- See more synonyms
- Siberian Ginseng P.E.
- Syringaresinol 4′-O-β-<span class="text-smallcaps">D</span>-glucopyranoside
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, 2,6-dimethoxy-4-[(1S,3aR,4S,6aR)-tetrahydro-4-(4-hydroxy-3,5-dimethoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]phenyl
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, 2,6-dimethoxy-4-[tetrahydro-4-(4-hydroxy-3,5-dimethoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]phenyl, [1S-(1α,3aα,4α,6aα)]-
- 1H,3H-Furo[3,4-c]furan, β-D-glucopyranoside deriv.
- Glucopyranoside, 2,6-dimethoxy-4-[tetrahydro-4-(4-hydroxy-3,5-dimethoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]phenyl, β-D-
- β-D-Glucopyranoside, 2,6-dimethoxy-4-[(1S,3aR,4S,6aR)-tetrahydro-4-(4-hydroxy-3,5-dimethoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]phenyl
- β-D-Glucopyranoside, 2,6-dimethoxy-4-[tetrahydro-4-(4-hydroxy-3,5-dimethoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]phenyl, [1S-(1α,3aα,4α,6aα)]-

b-D-Glucopyranoside,2,6-dimethoxy-4-[(1S,3aR,4S,6aR)-tetrahydro-4-(4-hydroxy-3,5-dimethoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]phenyl
Ref: IN-DA00ICFS
10mg | 200.00 € | ||
25mg | 272.00 € | ||
50mg | 612.00 € |

Acanthoside B
Ref: TM-TN1355
1mg | 74.00 € | ||
5mg | 160.00 € | ||
10mg | 235.00 € | ||
25mg | 376.00 € | ||
50mg | 560.00 € | ||
1mL*10mM (DMSO) | 130.00 € |

Eleutheroside E1
Ref: BP-SBP00183
20mg | 196.00 € |

Siberian ginseng P.E.
Ref: 3D-FS153847
5mg | 361.00 € | ||
10mg | 514.00 € | ||
25mg | 988.00 € | ||
50mg | 1,290.00 € | ||
100mg | 1,720.00 € |